C12H23N — CID 91069547
N-butan-2-yl-3,4-dimethylidenehexan-2-amine (PubChem CID 91069547) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N-butan-2-yl-3,4-dimethylidenehexan-2-amine.
| Compound Name | N-butan-2-yl-3,4-dimethylidenehexan-2-amine |
|---|---|
| PubChem CID | 91069547 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-butan-2-yl-3,4-dimethylidenehexan-2-amine |
| SMILES | C=C(CC)C(=C)C(C)NC(C)CC |
| InChI | InChI=1S/C12H23N/c1-7-9(3)11(5)12(6)13-10(4)8-2/h10,12-13H,3,5,7-8H2,1-2,4,6H3 |
| InChIKey | YHOKYNGOUDAOHO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|