C8H20N2 — CID 154626189
1-N'-butan-2-yl-1-N-ethylethane-1,1-diamine (PubChem CID 154626189) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is 1-N'-butan-2-yl-1-N-ethylethane-1,1-diamine.
| Compound Name | 1-N'-butan-2-yl-1-N-ethylethane-1,1-diamine |
|---|---|
| PubChem CID | 154626189 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 1-N'-butan-2-yl-1-N-ethylethane-1,1-diamine |
| SMILES | CCNC(C)NC(C)CC |
| InChI | InChI=1S/C8H20N2/c1-5-7(3)10-8(4)9-6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | HXAPPEXOGJLHIL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|