About 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine
1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine (PubChem CID 154626445) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine |
| PubChem CID | 154626445 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine |
| SMILES | CCCC(NCC)NC(C)CC |
| InChI | InChI=1S/C10H24N2/c1-5-8-10(11-7-3)12-9(4)6-2/h9-12H,5-8H2,1-4H3 |
| InChIKey | GYEMMINVZSSVDJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine?
The IUPAC name of 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine (CID 154626445) is 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine.
What is the SMILES notation for 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine?
The canonical SMILES for 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine is CCCC(NCC)NC(C)CC.
What is the InChIKey of 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine?
The InChIKey is GYEMMINVZSSVDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-5-8-10(11-7-3)12-9(4)6-2/h9-12H,5-8H2,1-4H3.
What are the key properties of 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine?
1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine has a molecular weight of 172.32 g/mol, XLogP of 2.11, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-butan-2-yl-1-N-ethylbutane-1,1-diamine is sourced from PubChem (CID 154626445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).