C10H24N2 — CID 154626442
1-N'-butan-2-yl-1-N-propan-2-ylpropane-1,1-diamine (PubChem CID 154626442) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 1-N'-butan-2-yl-1-N-propan-2-ylpropane-1,1-diamine.
| Compound Name | 1-N'-butan-2-yl-1-N-propan-2-ylpropane-1,1-diamine |
|---|---|
| PubChem CID | 154626442 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 1-N'-butan-2-yl-1-N-propan-2-ylpropane-1,1-diamine |
| SMILES | CCC(C)NC(CC)NC(C)C |
| InChI | InChI=1S/C10H24N2/c1-6-9(5)12-10(7-2)11-8(3)4/h8-12H,6-7H2,1-5H3 |
| InChIKey | ODIMDVPBOALYBV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|