C12H32N6 — CID 57293793
2-N-[1-[2,2-bis(methylamino)ethylamino]butyl]-1-N,1-N'-dimethylethane-1,1,2-triamine (PubChem CID 57293793) has the molecular formula C12H32N6 and a molecular weight of 260.43 g/mol. Its IUPAC name is 2-N-[1-[2,2-bis(methylamino)ethylamino]butyl]-1-N,1-N'-dimethylethane-1,1,2-triamine.
| Compound Name | 2-N-[1-[2,2-bis(methylamino)ethylamino]butyl]-1-N,1-N'-dimethylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 57293793 |
| Molecular Formula | C12H32N6 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.27 |
| IUPAC Name | 2-N-[1-[2,2-bis(methylamino)ethylamino]butyl]-1-N,1-N'-dimethylethane-1,1,2-triamine |
| SMILES | CCCC(NCC(NC)NC)NCC(NC)NC |
| InChI | InChI=1S/C12H32N6/c1-6-7-10(17-8-11(13-2)14-3)18-9-12(15-4)16-5/h10-18H,6-9H2,1-5H3 |
| InChIKey | KTZMGHWFYQWWHF-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|