C11H28N4 — CID 174247891
(1S)-1-N'-[1-(2,2-diethylhydrazinyl)ethyl]-1-N-methylbutane-1,1-diamine (PubChem CID 174247891) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is (1S)-1-N'-[1-(2,2-diethylhydrazinyl)ethyl]-1-N-methylbutane-1,1-diamine.
| Compound Name | (1S)-1-N'-[1-(2,2-diethylhydrazinyl)ethyl]-1-N-methylbutane-1,1-diamine |
|---|---|
| PubChem CID | 174247891 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | (1S)-1-N'-[1-(2,2-diethylhydrazinyl)ethyl]-1-N-methylbutane-1,1-diamine |
| SMILES | CCC[C@@H](NC)NC(C)NN(CC)CC |
| InChI | InChI=1S/C11H28N4/c1-6-9-11(12-5)13-10(4)14-15(7-2)8-3/h10-14H,6-9H2,1-5H3/t10?,11-/m0/s1 |
| InChIKey | CVGODKYXGIOTFC-DTIOYNMSSA-N |
| XLogP | 1.11 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|