C15H34N2 — CID 174146484
(1R)-1-N'-[(2S,3S)-5-ethyl-3-propylheptan-2-yl]-1-N-methylethane-1,1-diamine (PubChem CID 174146484) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is (1R)-1-N'-[(2S,3S)-5-ethyl-3-propylheptan-2-yl]-1-N-methylethane-1,1-diamine.
| Compound Name | (1R)-1-N'-[(2S,3S)-5-ethyl-3-propylheptan-2-yl]-1-N-methylethane-1,1-diamine |
|---|---|
| PubChem CID | 174146484 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | (1R)-1-N'-[(2S,3S)-5-ethyl-3-propylheptan-2-yl]-1-N-methylethane-1,1-diamine |
| SMILES | CCC[C@@H](CC(CC)CC)[C@H](C)N[C@H](C)NC |
| InChI | InChI=1S/C15H34N2/c1-7-10-15(11-14(8-2)9-3)12(4)17-13(5)16-6/h12-17H,7-11H2,1-6H3/t12-,13+,15-/m0/s1 |
| InChIKey | OSYBDWWWBOOABJ-GUTXKFCHSA-N |
| XLogP | 3.77 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|