C10H14O3 — CID 130126784
2,7-dihydroxy-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one (PubChem CID 130126784) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,7-dihydroxy-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one.
| Compound Name | 2,7-dihydroxy-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 130126784 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,7-dihydroxy-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
| SMILES | CC12C(=O)C(O)CC1CC=CC2O |
| InChI | InChI=1S/C10H14O3/c1-10-6(3-2-4-8(10)12)5-7(11)9(10)13/h2,4,6-8,11-12H,3,5H2,1H3 |
| InChIKey | HONRVAVEXCBUTO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|