C12H16O2 — CID 165343412
(1R,4aR,8aS)-5-(hydroxymethyl)-8a-methyl-4,4a-dihydro-1H-naphthalen-1-ol (PubChem CID 165343412) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,4aR,8aS)-5-(hydroxymethyl)-8a-methyl-4,4a-dihydro-1H-naphthalen-1-ol.
| Compound Name | (1R,4aR,8aS)-5-(hydroxymethyl)-8a-methyl-4,4a-dihydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 165343412 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R,4aR,8aS)-5-(hydroxymethyl)-8a-methyl-4,4a-dihydro-1H-naphthalen-1-ol |
| SMILES | C[C@]12C=CC=C(CO)[C@H]1CC=C[C@H]2O |
| InChI | InChI=1S/C12H16O2/c1-12-7-3-4-9(8-13)10(12)5-2-6-11(12)14/h2-4,6-7,10-11,13-14H,5,8H2,1H3/t10-,11-,12+/m1/s1 |
| InChIKey | MBENFFPPUABZDC-UTUOFQBUSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|