About (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate
(6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate (PubChem CID 174521140) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate.
Molecular Properties
| Compound Name | (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate |
| PubChem CID | 174521140 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(C)C(C)=CC=CC1O |
| InChI | InChI=1S/C10H14O3/c1-7-5-4-6-9(12)10(7,3)13-8(2)11/h4-6,9,12H,1-3H3 |
| InChIKey | ZEKUSIDLXZGDEG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate (CID 174521140) is (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1(C)C(C)=CC=CC1O.
What is the InChIKey of (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is ZEKUSIDLXZGDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-7-5-4-6-9(12)10(7,3)13-8(2)11/h4-6,9,12H,1-3H3.
What are the key properties of (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate?
(6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 182.22 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-hydroxy-1,2-dimethylcyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 174521140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).