About bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone
bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone (PubChem CID 175300526) has the molecular formula C21H30O
and a molecular weight of 298.47 g/mol. Its IUPAC name is bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone |
| PubChem CID | 175300526 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone |
| SMILES | CCC1(C)C(C)=CC=CC1C(=O)C1C=CC=C(C)C1(C)CC |
| InChI | InChI=1S/C21H30O/c1-7-20(5)15(3)11-9-13-17(20)19(22)18-14-10-12-16(4)21(18,6)8-2/h9-14,17-18H,7-8H2,1-6H3 |
| InChIKey | UKXMORPFWUYELQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone?
The IUPAC name of bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone (CID 175300526) is bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone.
What is the SMILES notation for bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone?
The canonical SMILES for bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone is CCC1(C)C(C)=CC=CC1C(=O)C1C=CC=C(C)C1(C)CC.
What is the InChIKey of bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone?
The InChIKey is UKXMORPFWUYELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O/c1-7-20(5)15(3)11-9-13-17(20)19(22)18-14-10-12-16(4)21(18,6)8-2/h9-14,17-18H,7-8H2,1-6H3.
What are the key properties of bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone?
bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone has a molecular weight of 298.47 g/mol, XLogP of 5.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone is sourced from PubChem (CID 175300526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).