C21H30O — CID 175300526
bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone (PubChem CID 175300526) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 175300526 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | bis(6-ethyl-5,6-dimethylcyclohexa-2,4-dien-1-yl)methanone |
| SMILES | CCC1(C)C(C)=CC=CC1C(=O)C1C=CC=C(C)C1(C)CC |
| InChI | InChI=1S/C21H30O/c1-7-20(5)15(3)11-9-13-17(20)19(22)18-14-10-12-16(4)21(18,6)8-2/h9-14,17-18H,7-8H2,1-6H3 |
| InChIKey | UKXMORPFWUYELQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |