C20H24O6 — CID 5248293
(6-acetyloxy-1,4,6,9-tetramethyl-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl) acetate (PubChem CID 5248293) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (6-acetyloxy-1,4,6,9-tetramethyl-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl) acetate.
| Compound Name | (6-acetyloxy-1,4,6,9-tetramethyl-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl) acetate |
|---|---|
| PubChem CID | 5248293 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (6-acetyloxy-1,4,6,9-tetramethyl-5,10-dioxo-9-tricyclo[6.2.2.02,7]dodeca-3,11-dienyl) acetate |
| SMILES | CC(=O)OC1(C)C(=O)C2(C)C=CC1C1C2C=C(C)C(=O)C1(C)OC(C)=O |
| InChI | InChI=1S/C20H24O6/c1-10-9-14-15(20(6,16(10)23)26-12(3)22)13-7-8-18(14,4)17(24)19(13,5)25-11(2)21/h7-9,13-15H,1-6H3 |
| InChIKey | XVPWMXFGGZGPMB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|