C21H28O2 — CID 584253
3',3',5',8',10',10'-hexamethylspiro[cyclobutane-2,4'-tricyclo[6.2.2.02,7]dodeca-5,11-diene]-1,9'-dione (PubChem CID 584253) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 3',3',5',8',10',10'-hexamethylspiro[cyclobutane-2,4'-tricyclo[6.2.2.02,7]dodeca-5,11-diene]-1,9'-dione.
| Compound Name | 3',3',5',8',10',10'-hexamethylspiro[cyclobutane-2,4'-tricyclo[6.2.2.02,7]dodeca-5,11-diene]-1,9'-dione |
|---|---|
| PubChem CID | 584253 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 3',3',5',8',10',10'-hexamethylspiro[cyclobutane-2,4'-tricyclo[6.2.2.02,7]dodeca-5,11-diene]-1,9'-dione |
| SMILES | CC1=CC2C(C3C=CC2(C)C(=O)C3(C)C)C(C)(C)C12CCC2=O |
| InChI | InChI=1S/C21H28O2/c1-12-11-14-16(19(4,5)21(12)10-8-15(21)22)13-7-9-20(14,6)17(23)18(13,2)3/h7,9,11,13-14,16H,8,10H2,1-6H3 |
| InChIKey | NNHRTHPXQSJCDK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|