About 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol
1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol (PubChem CID 130128243) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol.
Analyze 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The IUPAC name of 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol (CID 130128243) is 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol.
What is the SMILES notation for 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The canonical SMILES for 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol is CC(O)C1(C2(C)OCCO2)CC1.
What is the InChIKey of 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The InChIKey is DSEINJUVNIPBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-7(10)9(3-4-9)8(2)11-5-6-12-8/h7,10H,3-6H2,1-2H3.
What are the key properties of 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol has a molecular weight of 172.22 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2-methyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol is sourced from PubChem (CID 130128243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).