C11H20O2 — CID 130131017
3-(3-hydroxypropyl)-5,5-dimethylcyclohex-2-en-1-ol (PubChem CID 130131017) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-5,5-dimethylcyclohex-2-en-1-ol.
| Compound Name | 3-(3-hydroxypropyl)-5,5-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 130131017 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3-(3-hydroxypropyl)-5,5-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(CCCO)=CC(O)C1 |
| InChI | InChI=1S/C11H20O2/c1-11(2)7-9(4-3-5-12)6-10(13)8-11/h6,10,12-13H,3-5,7-8H2,1-2H3 |
| InChIKey | MMTFXBBBCQDKJY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|