C9H6Br3FO — CID 130137047
2,3-dibromo-1-(4-bromo-2-fluorophenyl)propan-1-one (PubChem CID 130137047) has the molecular formula C9H6Br3FO and a molecular weight of 388.86 g/mol. Its IUPAC name is 2,3-dibromo-1-(4-bromo-2-fluorophenyl)propan-1-one.
| Compound Name | 2,3-dibromo-1-(4-bromo-2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 130137047 |
| Molecular Formula | C9H6Br3FO |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 385.80 |
| IUPAC Name | 2,3-dibromo-1-(4-bromo-2-fluorophenyl)propan-1-one |
| SMILES | O=C(c1ccc(Br)cc1F)C(Br)CBr |
| InChI | InChI=1S/C9H6Br3FO/c10-4-7(12)9(14)6-2-1-5(11)3-8(6)13/h1-3,7H,4H2 |
| InChIKey | YCYMQMMBWMSYBH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|