C10H6Br3F3O2 — CID 146011302
2,3-dibromo-1-[4-bromo-2-(trifluoromethoxy)phenyl]propan-1-one (PubChem CID 146011302) has the molecular formula C10H6Br3F3O2 and a molecular weight of 454.86 g/mol. Its IUPAC name is 2,3-dibromo-1-[4-bromo-2-(trifluoromethoxy)phenyl]propan-1-one.
| Compound Name | 2,3-dibromo-1-[4-bromo-2-(trifluoromethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 146011302 |
| Molecular Formula | C10H6Br3F3O2 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 451.79 |
| IUPAC Name | 2,3-dibromo-1-[4-bromo-2-(trifluoromethoxy)phenyl]propan-1-one |
| SMILES | O=C(c1ccc(Br)cc1OC(F)(F)F)C(Br)CBr |
| InChI | InChI=1S/C10H6Br3F3O2/c11-4-7(13)9(17)6-2-1-5(12)3-8(6)18-10(14,15)16/h1-3,7H,4H2 |
| InChIKey | GDWDWDGVBNLJMU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|