C12H17NO3S — CID 130137485
(4-benzyl-1,1-dioxo-1,4-thiazinan-2-yl)methanol (PubChem CID 130137485) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is (4-benzyl-1,1-dioxo-1,4-thiazinan-2-yl)methanol.
| Compound Name | (4-benzyl-1,1-dioxo-1,4-thiazinan-2-yl)methanol |
|---|---|
| PubChem CID | 130137485 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (4-benzyl-1,1-dioxo-1,4-thiazinan-2-yl)methanol |
| SMILES | O=S1(=O)CCN(Cc2ccccc2)CC1CO |
| InChI | InChI=1S/C12H17NO3S/c14-10-12-9-13(6-7-17(12,15)16)8-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2 |
| InChIKey | RLKJCPULYMRGQT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |