C9H18O3 — CID 130148196
[6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]methanol (PubChem CID 130148196) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is [6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]methanol.
| Compound Name | [6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 130148196 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | [6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]methanol |
| SMILES | CC1CC(C)C(CO)OC1CO |
| InChI | InChI=1S/C9H18O3/c1-6-3-7(2)9(5-11)12-8(6)4-10/h6-11H,3-5H2,1-2H3 |
| InChIKey | MRJWXRHYKYBJMP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |