C9H20O4 — CID 156740552
ethane;(2S,5S)-6-(hydroxymethyl)-4-methyloxane-2,5-diol (PubChem CID 156740552) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is ethane;(2S,5S)-6-(hydroxymethyl)-4-methyloxane-2,5-diol.
| Compound Name | ethane;(2S,5S)-6-(hydroxymethyl)-4-methyloxane-2,5-diol |
|---|---|
| PubChem CID | 156740552 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | ethane;(2S,5S)-6-(hydroxymethyl)-4-methyloxane-2,5-diol |
| SMILES | CC.CC1C[C@@H](O)OC(CO)[C@H]1O |
| InChI | InChI=1S/C7H14O4.C2H6/c1-4-2-6(9)11-5(3-8)7(4)10;1-2/h4-10H,2-3H2,1H3;1-2H3/t4?,5?,6-,7-;/m0./s1 |
| InChIKey | XEUXHYQWERMUON-CQLVACSGSA-N |
| XLogP | 0.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |