C12H11BrIN — CID 130160897
1-(2-bromo-4-iodophenyl)-2,5-dimethylpyrrole (PubChem CID 130160897) has the molecular formula C12H11BrIN and a molecular weight of 376.04 g/mol. Its IUPAC name is 1-(2-bromo-4-iodophenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(2-bromo-4-iodophenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 130160897 |
| Molecular Formula | C12H11BrIN |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | 1-(2-bromo-4-iodophenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc(I)cc1Br |
| InChI | InChI=1S/C12H11BrIN/c1-8-3-4-9(2)15(8)12-6-5-10(14)7-11(12)13/h3-7H,1-2H3 |
| InChIKey | XXVNXIBNPIXALJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|