C12H11BrClN — CID 81275683
1-(2-bromo-5-chlorophenyl)-2,5-dimethylpyrrole (PubChem CID 81275683) has the molecular formula C12H11BrClN and a molecular weight of 284.58 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-2,5-dimethylpyrrole.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 81275683 |
| Molecular Formula | C12H11BrClN |
| Molecular Weight | 284.58 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C12H11BrClN/c1-8-3-4-9(2)15(8)12-7-10(14)5-6-11(12)13/h3-7H,1-2H3 |
| InChIKey | RMLDYLFJHWHPHI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|