C10H16N4 — CID 130168376
5,6-dimethyl-3-piperidin-1-yl-1,2,4-triazine (PubChem CID 130168376) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5,6-dimethyl-3-piperidin-1-yl-1,2,4-triazine.
| Compound Name | 5,6-dimethyl-3-piperidin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 130168376 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5,6-dimethyl-3-piperidin-1-yl-1,2,4-triazine |
| SMILES | Cc1nnc(N2CCCCC2)nc1C |
| InChI | InChI=1S/C10H16N4/c1-8-9(2)12-13-10(11-8)14-6-4-3-5-7-14/h3-7H2,1-2H3 |
| InChIKey | LEJOBNJYVUFCHS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |