C16H17N3O6 — CID 130177678
ethyl 2-hydroxy-6-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,2-dihydropyrimidine-5-carboxylate (PubChem CID 130177678) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is ethyl 2-hydroxy-6-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,2-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 2-hydroxy-6-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,2-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 130177678 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | ethyl 2-hydroxy-6-oxo-3-[4-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,2-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=CN(c2ccc(N3CCOC3=O)cc2)C(O)NC1=O |
| InChI | InChI=1S/C16H17N3O6/c1-2-24-14(21)12-9-19(15(22)17-13(12)20)11-5-3-10(4-6-11)18-7-8-25-16(18)23/h3-6,9,15,22H,2,7-8H2,1H3,(H,17,20) |
| InChIKey | YPPXEBDINRAGJH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|