C31H58N6O7S — CID 130178766
N-[4-(dimethylamino)butyl]-N'-[3-[2-[2-[3-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanediamide (PubChem CID 130178766) has the molecular formula C31H58N6O7S and a molecular weight of 658.91 g/mol. Its IUPAC name is N-[4-(dimethylamino)butyl]-N'-[3-[2-[2-[3-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanediamide.
| Compound Name | N-[4-(dimethylamino)butyl]-N'-[3-[2-[2-[3-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanediamide |
|---|---|
| PubChem CID | 130178766 |
| Molecular Formula | C31H58N6O7S |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.41 |
| IUPAC Name | N-[4-(dimethylamino)butyl]-N'-[3-[2-[2-[3-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]propoxy]ethoxy]ethoxy]propyl]pentanediamide |
| SMILES | CN(C)CCCCNC(=O)CCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCC[C@@H]1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C31H58N6O7S/c1-37(2)17-6-5-14-32-28(39)12-7-13-29(40)34-16-9-19-43-21-23-44-22-20-42-18-8-15-33-27(38)11-4-3-10-26-30-25(24-45-26)35-31(41)36-30/h25-26,30H,3-24H2,1-2H3,(H,32,39)(H,33,38)(H,34,40)(H2,35,36,41)/t25?,26-,30?/m0/s1 |
| InChIKey | UBJRIGCNCWXDNX-XTQOWRHRSA-N |
| XLogP | 1.40 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|