About 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene
3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 130179158) has the molecular formula C11H17F
and a molecular weight of 168.25 g/mol. Its IUPAC name is 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene.
Analyze 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene?
The IUPAC name of 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene (CID 130179158) is 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene.
What is the SMILES notation for 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene?
The canonical SMILES for 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene is CC1=CCC(C)(C(C)C)C=C1F.
What is the InChIKey of 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene?
The InChIKey is AILCEICFDFCEAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F/c1-8(2)11(4)6-5-9(3)10(12)7-11/h5,7-8H,6H2,1-4H3.
What are the key properties of 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene?
3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene has a molecular weight of 168.25 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,5-dimethyl-5-propan-2-ylcyclohexa-1,3-diene is sourced from PubChem (CID 130179158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).