C13H23N — CID 155036257
2,6-dimethyl-2,5-di(propan-2-yl)-3H-pyridine (PubChem CID 155036257) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 2,6-dimethyl-2,5-di(propan-2-yl)-3H-pyridine.
| Compound Name | 2,6-dimethyl-2,5-di(propan-2-yl)-3H-pyridine |
|---|---|
| PubChem CID | 155036257 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2,6-dimethyl-2,5-di(propan-2-yl)-3H-pyridine |
| SMILES | CC1=NC(C)(C(C)C)CC=C1C(C)C |
| InChI | InChI=1S/C13H23N/c1-9(2)12-7-8-13(6,10(3)4)14-11(12)5/h7,9-10H,8H2,1-6H3 |
| InChIKey | CURJZXLWWSYSOM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |