About 3,5-difluoro-2-methylcyclohepta-1,3,5-triene
3,5-difluoro-2-methylcyclohepta-1,3,5-triene (PubChem CID 142115585) has the molecular formula C8H8F2
and a molecular weight of 142.15 g/mol. Its IUPAC name is 3,5-difluoro-2-methylcyclohepta-1,3,5-triene.
Analyze 3,5-difluoro-2-methylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-2-methylcyclohepta-1,3,5-triene?
The IUPAC name of 3,5-difluoro-2-methylcyclohepta-1,3,5-triene (CID 142115585) is 3,5-difluoro-2-methylcyclohepta-1,3,5-triene.
What is the SMILES notation for 3,5-difluoro-2-methylcyclohepta-1,3,5-triene?
The canonical SMILES for 3,5-difluoro-2-methylcyclohepta-1,3,5-triene is CC1=CCC=C(F)C=C1F.
What is the InChIKey of 3,5-difluoro-2-methylcyclohepta-1,3,5-triene?
The InChIKey is JUKWGMOARUPGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2/c1-6-3-2-4-7(9)5-8(6)10/h3-5H,2H2,1H3.
What are the key properties of 3,5-difluoro-2-methylcyclohepta-1,3,5-triene?
3,5-difluoro-2-methylcyclohepta-1,3,5-triene has a molecular weight of 142.15 g/mol, XLogP of 3.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-2-methylcyclohepta-1,3,5-triene is sourced from PubChem (CID 142115585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).