C19H24N6O5S — CID 130179288
[(1R,2R)-2-hydroxy-3-[[5-(1-pent-3-yn-2-ylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 130179288) has the molecular formula C19H24N6O5S and a molecular weight of 448.51 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-3-[[5-(1-pent-3-yn-2-ylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R)-2-hydroxy-3-[[5-(1-pent-3-yn-2-ylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 130179288 |
| Molecular Formula | C19H24N6O5S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(1R,2R)-2-hydroxy-3-[[5-(1-pent-3-yn-2-ylpyrazole-3-carbonyl)pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | CC#CC(C)n1ccc(C(=O)c2cncnc2NC2CC[C@H](COS(N)(=O)=O)[C@H]2O)n1 |
| InChI | InChI=1S/C19H24N6O5S/c1-3-4-12(2)25-8-7-16(24-25)18(27)14-9-21-11-22-19(14)23-15-6-5-13(17(15)26)10-30-31(20,28)29/h7-9,11-13,15,17,26H,5-6,10H2,1-2H3,(H2,20,28,29)(H,21,22,23)/t12?,13-,15?,17-/m1/s1 |
| InChIKey | QIBLYZDJBYFUDK-YHTQSWCFSA-N |
| XLogP | 0.26 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|