C23H29N5O6S — CID 163454793
[(1R,2R,3S,4R)-2,3-dihydroxy-4-[[5-[1-(2-methylpropyl)indole-3-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 163454793) has the molecular formula C23H29N5O6S and a molecular weight of 503.58 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[5-[1-(2-methylpropyl)indole-3-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[5-[1-(2-methylpropyl)indole-3-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 163454793 |
| Molecular Formula | C23H29N5O6S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-[[5-[1-(2-methylpropyl)indole-3-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | CC(C)Cn1cc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C23H29N5O6S/c1-13(2)9-28-10-17(15-5-3-4-6-19(15)28)21(30)16-8-25-12-26-23(16)27-18-7-14(20(29)22(18)31)11-34-35(24,32)33/h3-6,8,10,12-14,18,20,22,29,31H,7,9,11H2,1-2H3,(H2,24,32,33)(H,25,26,27)/t14-,18-,20-,22+/m1/s1 |
| InChIKey | BJNHLYUSQYJVEL-YFCKSIHTSA-N |
| XLogP | 1.06 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |