C27H27F2N5O7S — CID 163895939
[(1R,2R,3S,4R)-4-[[5-[5-fluoro-1-[(4-fluoro-3-methoxyphenyl)methyl]indole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 163895939) has the molecular formula C27H27F2N5O7S and a molecular weight of 603.60 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[5-fluoro-1-[(4-fluoro-3-methoxyphenyl)methyl]indole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[5-fluoro-1-[(4-fluoro-3-methoxyphenyl)methyl]indole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 163895939 |
| Molecular Formula | C27H27F2N5O7S |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[5-fluoro-1-[(4-fluoro-3-methoxyphenyl)methyl]indole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | COc1cc(Cn2cc(C(=O)c3cncnc3N[C@@H]3C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]3O)c3cc(F)ccc32)ccc1F |
| InChI | InChI=1S/C27H27F2N5O7S/c1-40-23-6-14(2-4-20(23)29)10-34-11-19(17-8-16(28)3-5-22(17)34)25(36)18-9-31-13-32-27(18)33-21-7-15(24(35)26(21)37)12-41-42(30,38)39/h2-6,8-9,11,13,15,21,24,26,35,37H,7,10,12H2,1H3,(H2,30,38,39)(H,31,32,33)/t15-,21-,24-,26+/m1/s1 |
| InChIKey | QFPLTCPZMZFYDS-NWGSJDEISA-N |
| XLogP | 1.74 |
| TPSA | 178.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |