C33H32BrN5O7S — CID 163547905
[(2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-phenylmethoxyindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 163547905) has the molecular formula C33H32BrN5O7S and a molecular weight of 722.62 g/mol. Its IUPAC name is [(2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-phenylmethoxyindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-phenylmethoxyindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 163547905 |
| Molecular Formula | C33H32BrN5O7S |
| Molecular Weight | 722.62 g/mol |
| Exact Mass | 721.12 |
| IUPAC Name | [(2R,3S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]-5-phenylmethoxyindole-3-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OCC1C[C@@H](Nc2ncncc2C(=O)c2cn(Cc3cccc(Br)c3)c3ccc(OCc4ccccc4)cc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H32BrN5O7S/c34-23-8-4-7-21(11-23)15-39-16-27(25-13-24(9-10-29(25)39)45-17-20-5-2-1-3-6-20)31(41)26-14-36-19-37-33(26)38-28-12-22(30(40)32(28)42)18-46-47(35,43)44/h1-11,13-14,16,19,22,28,30,32,40,42H,12,15,17-18H2,(H2,35,43,44)(H,36,37,38)/t22?,28-,30-,32+/m1/s1 |
| InChIKey | FGPPNEOZUJTLBR-PCHIMFLESA-N |
| XLogP | 3.79 |
| TPSA | 178.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |