C24H28F3N3O4 — CID 130180052
N-[(4-benzoylmorpholin-3-yl)methyl]-2-methyl-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide (PubChem CID 130180052) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-[(4-benzoylmorpholin-3-yl)methyl]-2-methyl-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide.
| Compound Name | N-[(4-benzoylmorpholin-3-yl)methyl]-2-methyl-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 130180052 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[(4-benzoylmorpholin-3-yl)methyl]-2-methyl-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide |
| SMILES | Cc1cc(C(C)NC(O)C(F)(F)F)ccc1C(=O)NCC1COCCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H28F3N3O4/c1-15-12-18(16(2)29-23(33)24(25,26)27)8-9-20(15)21(31)28-13-19-14-34-11-10-30(19)22(32)17-6-4-3-5-7-17/h3-9,12,16,19,23,29,33H,10-11,13-14H2,1-2H3,(H,28,31) |
| InChIKey | PTHRINJCLWHRQW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|