C20H27F3N4O5 — CID 130180462
N-[[(3R)-4-[(Z)-4-amino-2-hydroxybut-2-enoyl]morpholin-3-yl]methyl]-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide (PubChem CID 130180462) has the molecular formula C20H27F3N4O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is N-[[(3R)-4-[(Z)-4-amino-2-hydroxybut-2-enoyl]morpholin-3-yl]methyl]-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide.
| Compound Name | N-[[(3R)-4-[(Z)-4-amino-2-hydroxybut-2-enoyl]morpholin-3-yl]methyl]-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 130180462 |
| Molecular Formula | C20H27F3N4O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[[(3R)-4-[(Z)-4-amino-2-hydroxybut-2-enoyl]morpholin-3-yl]methyl]-4-[1-[(2,2,2-trifluoro-1-hydroxyethyl)amino]ethyl]benzamide |
| SMILES | CC(NC(O)C(F)(F)F)c1ccc(C(=O)NC[C@@H]2COCCN2C(=O)/C(O)=C/CN)cc1 |
| InChI | InChI=1S/C20H27F3N4O5/c1-12(26-19(31)20(21,22)23)13-2-4-14(5-3-13)17(29)25-10-15-11-32-9-8-27(15)18(30)16(28)6-7-24/h2-6,12,15,19,26,28,31H,7-11,24H2,1H3,(H,25,29)/b16-6-/t12?,15-,19?/m1/s1 |
| InChIKey | ZMSXZKSBHDPIKT-NPODTYSESA-N |
| XLogP | 0.58 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|