About 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide
2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 130180953) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 130180953 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CCN(CC)CC(=O)NC1=C(C)CCC=C1C |
| InChI | InChI=1S/C14H24N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h8H,5-7,9-10H2,1-4H3,(H,15,17) |
| InChIKey | AVFDRBNFYIUFMH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide (CID 130180953) is 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide is CCN(CC)CC(=O)NC1=C(C)CCC=C1C.
What is the InChIKey of 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is AVFDRBNFYIUFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4/h8H,5-7,9-10H2,1-4H3,(H,15,17).
What are the key properties of 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide?
2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 236.36 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-N-(2,6-dimethylcyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 130180953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).