About 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone
1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone (PubChem CID 130181656) has the molecular formula C25H23NO
and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone |
| PubChem CID | 130181656 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone |
| SMILES | CCn1c2ccc(C(C)=O)cc2c2cc3c(cc21)-c1ccccc1C3(C)C |
| InChI | InChI=1S/C25H23NO/c1-5-26-23-11-10-16(15(2)27)12-19(23)20-13-22-18(14-24(20)26)17-8-6-7-9-21(17)25(22,3)4/h6-14H,5H2,1-4H3 |
| InChIKey | WQTCCZCVKYZEGF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone?
The IUPAC name of 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone (CID 130181656) is 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone.
What is the SMILES notation for 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone?
The canonical SMILES for 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone is CCn1c2ccc(C(C)=O)cc2c2cc3c(cc21)-c1ccccc1C3(C)C.
What is the InChIKey of 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone?
The InChIKey is WQTCCZCVKYZEGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO/c1-5-26-23-11-10-16(15(2)27)12-19(23)20-13-22-18(14-24(20)26)17-8-6-7-9-21(17)25(22,3)4/h6-14H,5H2,1-4H3.
What are the key properties of 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone?
1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone has a molecular weight of 353.47 g/mol, XLogP of 6.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-11,11-dimethylindeno[1,2-b]carbazol-2-yl)ethanone is sourced from PubChem (CID 130181656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).