C21H21N3O5S — CID 130182397
3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-oxo-1H-quinoline-6-sulfinic acid (PubChem CID 130182397) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-oxo-1H-quinoline-6-sulfinic acid.
| Compound Name | 3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-oxo-1H-quinoline-6-sulfinic acid |
|---|---|
| PubChem CID | 130182397 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-4-oxo-1H-quinoline-6-sulfinic acid |
| SMILES | COc1ccc(N2CCN(C(=O)c3c[nH]c4ccc(S(=O)O)cc4c3=O)CC2)cc1 |
| InChI | InChI=1S/C21H21N3O5S/c1-29-15-4-2-14(3-5-15)23-8-10-24(11-9-23)21(26)18-13-22-19-7-6-16(30(27)28)12-17(19)20(18)25/h2-7,12-13H,8-11H2,1H3,(H,22,25)(H,27,28) |
| InChIKey | OAHWWGJVQXXQDE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|