C10H14ClN4O3S- — CID 130187548
[4-(4-chloropyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinate (PubChem CID 130187548) has the molecular formula C10H14ClN4O3S- and a molecular weight of 305.77 g/mol. Its IUPAC name is [4-(4-chloropyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinate.
| Compound Name | [4-(4-chloropyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 130187548 |
| Molecular Formula | C10H14ClN4O3S- |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [4-(4-chloropyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinate |
| SMILES | O=C(N1CCCN(CS(=O)[O-])CC1)n1cc(Cl)cn1 |
| InChI | InChI=1S/C10H15ClN4O3S/c11-9-6-12-15(7-9)10(16)14-3-1-2-13(4-5-14)8-19(17)18/h6-7H,1-5,8H2,(H,17,18)/p-1 |
| InChIKey | UDKMGMNKWWYLEH-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|