C11H15N5O3S — CID 130187545
[4-(4-cyanopyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinic acid (PubChem CID 130187545) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is [4-(4-cyanopyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinic acid.
| Compound Name | [4-(4-cyanopyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 130187545 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | [4-(4-cyanopyrazole-1-carbonyl)-1,4-diazepan-1-yl]methanesulfinic acid |
| SMILES | N#Cc1cnn(C(=O)N2CCCN(CS(=O)O)CC2)c1 |
| InChI | InChI=1S/C11H15N5O3S/c12-6-10-7-13-16(8-10)11(17)15-3-1-2-14(4-5-15)9-20(18)19/h7-8H,1-5,9H2,(H,18,19) |
| InChIKey | CWSUXEUWHRGZTA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|