C18H26ClNO6S — CID 130191273
tert-butyl N-[4-chloro-2-hydroxy-3-[2-[(3S)-oxolan-3-yl]propan-2-ylsulfonyl]phenyl]carbamate (PubChem CID 130191273) has the molecular formula C18H26ClNO6S and a molecular weight of 419.93 g/mol. Its IUPAC name is tert-butyl N-[4-chloro-2-hydroxy-3-[2-[(3S)-oxolan-3-yl]propan-2-ylsulfonyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-chloro-2-hydroxy-3-[2-[(3S)-oxolan-3-yl]propan-2-ylsulfonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 130191273 |
| Molecular Formula | C18H26ClNO6S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | tert-butyl N-[4-chloro-2-hydroxy-3-[2-[(3S)-oxolan-3-yl]propan-2-ylsulfonyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Cl)c(S(=O)(=O)C(C)(C)[C@H]2CCOC2)c1O |
| InChI | InChI=1S/C18H26ClNO6S/c1-17(2,3)26-16(22)20-13-7-6-12(19)15(14(13)21)27(23,24)18(4,5)11-8-9-25-10-11/h6-7,11,21H,8-10H2,1-5H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | BAESCESMWHDTEP-NSHDSACASA-N |
| XLogP | 3.98 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|