C13H16ClNO6S — CID 175338288
[4-chloro-2-hydroxy-3-[2-(oxetan-3-yl)propan-2-ylsulfonyl]phenyl] carbamate (PubChem CID 175338288) has the molecular formula C13H16ClNO6S and a molecular weight of 349.79 g/mol. Its IUPAC name is [4-chloro-2-hydroxy-3-[2-(oxetan-3-yl)propan-2-ylsulfonyl]phenyl] carbamate.
| Compound Name | [4-chloro-2-hydroxy-3-[2-(oxetan-3-yl)propan-2-ylsulfonyl]phenyl] carbamate |
|---|---|
| PubChem CID | 175338288 |
| Molecular Formula | C13H16ClNO6S |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | [4-chloro-2-hydroxy-3-[2-(oxetan-3-yl)propan-2-ylsulfonyl]phenyl] carbamate |
| SMILES | CC(C)(C1COC1)S(=O)(=O)c1c(Cl)ccc(OC(N)=O)c1O |
| InChI | InChI=1S/C13H16ClNO6S/c1-13(2,7-5-20-6-7)22(18,19)11-8(14)3-4-9(10(11)16)21-12(15)17/h3-4,7,16H,5-6H2,1-2H3,(H2,15,17) |
| InChIKey | DVMGVQFCMHGIPS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |