C14H25NS — CID 130195812
(3E,5E)-4-ethyl-N-methyl-5-methylsulfanyl-N-propylhepta-1,3,5-trien-3-amine (PubChem CID 130195812) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is (3E,5E)-4-ethyl-N-methyl-5-methylsulfanyl-N-propylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-4-ethyl-N-methyl-5-methylsulfanyl-N-propylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 130195812 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (3E,5E)-4-ethyl-N-methyl-5-methylsulfanyl-N-propylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C(CC)\C(=C/C)SC)N(C)CCC |
| InChI | InChI=1S/C14H25NS/c1-7-11-15(5)13(9-3)12(8-2)14(10-4)16-6/h9-10H,3,7-8,11H2,1-2,4-6H3/b13-12+,14-10+ |
| InChIKey | YLJVGZJAUTWQSV-GTDMLIFZSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|