C63H38O12S — CID 130205724
2,2,2-tris(3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)ethyl methanesulfonate (PubChem CID 130205724) has the molecular formula C63H38O12S and a molecular weight of 1019.05 g/mol. Its IUPAC name is 2,2,2-tris(3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)ethyl methanesulfonate.
| Compound Name | 2,2,2-tris(3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 130205724 |
| Molecular Formula | C63H38O12S |
| Molecular Weight | 1019.05 g/mol |
| Exact Mass | 1018.21 |
| IUPAC Name | 2,2,2-tris(3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC(c1cccc2c1C(=O)OC21c2ccccc2Oc2ccccc21)(c1cccc2c1C(=O)OC21c2ccccc2Oc2ccccc21)c1cccc2c1C(=O)OC21c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C63H38O12S/c1-76(67,68)69-35-60(42-23-14-26-45-54(42)57(64)73-61(45)36-17-2-8-29-48(36)70-49-30-9-3-18-37(49)61,43-24-15-27-46-55(43)58(65)74-62(46)38-19-4-10-31-50(38)71-51-32-11-5-20-39(51)62)44-25-16-28-47-56(44)59(66)75-63(47)40-21-6-12-33-52(40)72-53-34-13-7-22-41(53)63/h2-34H,35H2,1H3 |
| InChIKey | ZAIKZAVTKZOXMB-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.05 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|