C24H20BrNO3 — CID 68970232
7-bromo-5-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 68970232) has the molecular formula C24H20BrNO3 and a molecular weight of 450.33 g/mol. Its IUPAC name is 7-bromo-5-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7-bromo-5-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 68970232 |
| Molecular Formula | C24H20BrNO3 |
| Molecular Weight | 450.33 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 7-bromo-5-(diethylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1cc(Br)c2c(c1)C1(OC2=O)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C24H20BrNO3/c1-3-26(4-2)15-13-18-22(19(25)14-15)23(27)29-24(18)16-9-5-7-11-20(16)28-21-12-8-6-10-17(21)24/h5-14H,3-4H2,1-2H3 |
| InChIKey | JGGBIJYSEQWZLR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |