C9H11N3 — CID 130207580
2,2-dimethylpyrimido[1,2-c]pyrimidine (PubChem CID 130207580) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 2,2-dimethylpyrimido[1,2-c]pyrimidine.
| Compound Name | 2,2-dimethylpyrimido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 130207580 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2,2-dimethylpyrimido[1,2-c]pyrimidine |
| SMILES | CC1(C)C=CN2C=NC=CC2=N1 |
| InChI | InChI=1S/C9H11N3/c1-9(2)4-6-12-7-10-5-3-8(12)11-9/h3-7H,1-2H3 |
| InChIKey | SEYFGMPXXVBOPJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |