C10H12N2 — CID 142063287
2,2-dimethylpyrido[1,2-a]pyrimidine (PubChem CID 142063287) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,2-dimethylpyrido[1,2-a]pyrimidine.
| Compound Name | 2,2-dimethylpyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142063287 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2,2-dimethylpyrido[1,2-a]pyrimidine |
| SMILES | CC1(C)C=CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C10H12N2/c1-10(2)6-8-12-7-4-3-5-9(12)11-10/h3-8H,1-2H3 |
| InChIKey | FLAXSZZGJNBZQG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |