C10H13N3Y-2 — CID 59953000
N,N-dimethyl-1-[(2-methyl-3H-pyridin-3-id-4-yl)methylimino]methanamine;yttrium (PubChem CID 59953000) has the molecular formula C10H13N3Y-2 and a molecular weight of 264.14 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2-methyl-3H-pyridin-3-id-4-yl)methylimino]methanamine;yttrium.
| Compound Name | N,N-dimethyl-1-[(2-methyl-3H-pyridin-3-id-4-yl)methylimino]methanamine;yttrium |
|---|---|
| PubChem CID | 59953000 |
| Molecular Formula | C10H13N3Y-2 |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | N,N-dimethyl-1-[(2-methyl-3H-pyridin-3-id-4-yl)methylimino]methanamine;yttrium |
| SMILES | Cc1[c-]c(C/N=[C-]/N(C)C)ccn1.[Y] |
| InChI | InChI=1S/C10H13N3.Y/c1-9-6-10(4-5-12-9)7-11-8-13(2)3;/h4-5H,7H2,1-3H3;/q-2; |
| InChIKey | QZJCHIDFDRCPHQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|