C23H19N3O3 — CID 130207903
N-hydroxy-2-[4-[3-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]but-3-en-1-ynyl]phenyl]-1,6-naphthyridine-4-carboxamide (PubChem CID 130207903) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-hydroxy-2-[4-[3-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]but-3-en-1-ynyl]phenyl]-1,6-naphthyridine-4-carboxamide.
| Compound Name | N-hydroxy-2-[4-[3-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]but-3-en-1-ynyl]phenyl]-1,6-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 130207903 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-hydroxy-2-[4-[3-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]but-3-en-1-ynyl]phenyl]-1,6-naphthyridine-4-carboxamide |
| SMILES | C=C(C#Cc1ccc(-c2cc(C(=O)NO)c3cnccc3n2)cc1)[C@@H]1C[C@H]1CO |
| InChI | InChI=1S/C23H19N3O3/c1-14(18-10-17(18)13-27)2-3-15-4-6-16(7-5-15)22-11-19(23(28)26-29)20-12-24-9-8-21(20)25-22/h4-9,11-12,17-18,27,29H,1,10,13H2,(H,26,28)/t17-,18-/m0/s1 |
| InChIKey | CLLFHTVMIKDLBW-ROUUACIJSA-N |
| XLogP | 2.95 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|