C30H35N7O3 — CID 130208482
methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindole-7-carboxylate (PubChem CID 130208482) has the molecular formula C30H35N7O3 and a molecular weight of 541.66 g/mol. Its IUPAC name is methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindole-7-carboxylate.
| Compound Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindole-7-carboxylate |
|---|---|
| PubChem CID | 130208482 |
| Molecular Formula | C30H35N7O3 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | methyl 3-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methyl-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]-1-methylindole-7-carboxylate |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C)c4c(C(=O)OC)cccc34)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C30H35N7O3/c1-8-27(38)32-25-17-24(19(2)16-26(25)36(5)15-14-35(3)4)34-30-31-13-12-23(33-30)22-18-37(6)28-20(22)10-9-11-21(28)29(39)40-7/h8-13,16-18H,1,14-15H2,2-7H3,(H,32,38)(H,31,33,34) |
| InChIKey | HGXHSGHHJDKTMU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|