C26H29IN8O — CID 165033554
N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(8-iodoimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-4-methylphenyl]prop-2-enamide (PubChem CID 165033554) has the molecular formula C26H29IN8O and a molecular weight of 596.48 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(8-iodoimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-4-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(8-iodoimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-4-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 165033554 |
| Molecular Formula | C26H29IN8O |
| Molecular Weight | 596.48 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(8-iodoimidazo[1,2-a]pyridin-3-yl)pyrimidin-2-yl]amino]-4-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(-c3cnc4c(I)cccn34)n2)c(C)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C26H29IN8O/c1-6-24(36)30-21-15-20(17(2)14-22(21)34(5)13-12-33(3)4)32-26-28-10-9-19(31-26)23-16-29-25-18(27)8-7-11-35(23)25/h6-11,14-16H,1,12-13H2,2-5H3,(H,30,36)(H,28,31,32) |
| InChIKey | NAMJTPRKFUOZRE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|